C29H29N5O3S — CID 100572080
2-methoxy-N-[4-[(4R,5S)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100572080) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is 2-methoxy-N-[4-[(4R,5S)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[(4R,5S)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100572080 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-methoxy-N-[4-[(4R,5S)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccc(C)n2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H29N5O3S/c1-19-7-16-25(33(19)21-12-14-23(37-3)15-13-21)28-27(24-6-4-5-17-30-24)32-29(38)34(28)22-10-8-20(9-11-22)31-26(35)18-36-2/h4-17,27-28H,18H2,1-3H3,(H,31,35)(H,32,38)/t27-,28+/m0/s1 |
| InChIKey | BSPWQZMILJIREP-WUFINQPMSA-N |
| XLogP | 4.95 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|