C28H26ClN5O2S — CID 133243402
N-[2-chloro-4-[5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide (PubChem CID 133243402) has the molecular formula C28H26ClN5O2S and a molecular weight of 532.07 g/mol. Its IUPAC name is N-[2-chloro-4-[5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[2-chloro-4-[5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 133243402 |
| Molecular Formula | C28H26ClN5O2S |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | N-[2-chloro-4-[5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(C)n2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C28H26ClN5O2S/c1-18-11-14-24(33(18)19-8-4-3-5-9-19)27-26(23-10-6-7-15-30-23)32-28(37)34(27)20-12-13-22(21(29)16-20)31-25(35)17-36-2/h3-16,26-27H,17H2,1-2H3,(H,31,35)(H,32,37) |
| InChIKey | AQHMJWJLXCNGRT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|