C29H27Cl2N5O2S — CID 133243313
N-[2-chloro-4-[5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide (PubChem CID 133243313) has the molecular formula C29H27Cl2N5O2S and a molecular weight of 580.54 g/mol. Its IUPAC name is N-[2-chloro-4-[5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[2-chloro-4-[5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 133243313 |
| Molecular Formula | C29H27Cl2N5O2S |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | N-[2-chloro-4-[5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(Cl)cc3)c2C)cc1Cl |
| InChI | InChI=1S/C29H27Cl2N5O2S/c1-17-14-22(18(2)35(17)20-9-7-19(30)8-10-20)28-27(25-6-4-5-13-32-25)34-29(39)36(28)21-11-12-24(23(31)15-21)33-26(37)16-38-3/h4-15,27-28H,16H2,1-3H3,(H,33,37)(H,34,39) |
| InChIKey | RSHKDZOEUUNGFI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|