C29H28ClN5O3S — CID 100575044
N-[2-chloro-4-[(4S,5S)-5-[1-(2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide (PubChem CID 100575044) has the molecular formula C29H28ClN5O3S and a molecular weight of 562.10 g/mol. Its IUPAC name is N-[2-chloro-4-[(4S,5S)-5-[1-(2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[2-chloro-4-[(4S,5S)-5-[1-(2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 100575044 |
| Molecular Formula | C29H28ClN5O3S |
| Molecular Weight | 562.10 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | N-[2-chloro-4-[(4S,5S)-5-[1-(2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccccc3O)c2C)cc1Cl |
| InChI | InChI=1S/C29H28ClN5O3S/c1-17-14-20(18(2)34(17)24-9-4-5-10-25(24)36)28-27(23-8-6-7-13-31-23)33-29(39)35(28)19-11-12-22(21(30)15-19)32-26(37)16-38-3/h4-15,27-28,36H,16H2,1-3H3,(H,32,37)(H,33,39)/t27-,28+/m1/s1 |
| InChIKey | NUEMDLIYAVZWJD-IZLXSDGUSA-N |
| XLogP | 5.61 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.10 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|