C25H18Cl3N3O2S — CID 133224564
1-(3-chloro-4-methoxyphenyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224564) has the molecular formula C25H18Cl3N3O2S and a molecular weight of 530.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224564 |
| Molecular Formula | C25H18Cl3N3O2S |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cccc(Cl)c3Cl)o2)cc1Cl |
| InChI | InChI=1S/C25H18Cl3N3O2S/c1-32-20-9-8-14(13-17(20)27)31-24(23(30-25(31)34)18-7-2-3-12-29-18)21-11-10-19(33-21)15-5-4-6-16(26)22(15)28/h2-13,23-24H,1H3,(H,30,34) |
| InChIKey | KRLGZKRLHGZAJS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|