C26H21Cl2N3OS — CID 133158267
5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3,4-dimethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158267) has the molecular formula C26H21Cl2N3OS and a molecular weight of 494.45 g/mol. Its IUPAC name is 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3,4-dimethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3,4-dimethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158267 |
| Molecular Formula | C26H21Cl2N3OS |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3,4-dimethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cccc(Cl)c3Cl)o2)cc1C |
| InChI | InChI=1S/C26H21Cl2N3OS/c1-15-9-10-17(14-16(15)2)31-25(24(30-26(31)33)20-8-3-4-13-29-20)22-12-11-21(32-22)18-6-5-7-19(27)23(18)28/h3-14,24-25H,1-2H3,(H,30,33) |
| InChIKey | CSFXESSVFNHWJB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|