C26H20ClN3O3S — CID 133157089
1-(1,3-benzodioxol-5-yl)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157089) has the molecular formula C26H20ClN3O3S and a molecular weight of 489.98 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157089 |
| Molecular Formula | C26H20ClN3O3S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(Cl)cccc1-c1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C26H20ClN3O3S/c1-15-17(5-4-6-18(15)27)20-10-11-22(33-20)25-24(19-7-2-3-12-28-19)29-26(34)30(25)16-8-9-21-23(13-16)32-14-31-21/h2-13,24-25H,14H2,1H3,(H,29,34) |
| InChIKey | OXWWIVOUEWTXNX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|