C24H27ClN4OS — CID 133223339
5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-[3-(dimethylamino)propyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223339) has the molecular formula C24H27ClN4OS and a molecular weight of 455.03 g/mol. Its IUPAC name is 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-[3-(dimethylamino)propyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-[3-(dimethylamino)propyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223339 |
| Molecular Formula | C24H27ClN4OS |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-[3-(dimethylamino)propyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(Cl)cccc1-c1ccc(C2C(c3ccccn3)NC(=S)N2CCCN(C)C)o1 |
| InChI | InChI=1S/C24H27ClN4OS/c1-16-17(8-6-9-18(16)25)20-11-12-21(30-20)23-22(19-10-4-5-13-26-19)27-24(31)29(23)15-7-14-28(2)3/h4-6,8-13,22-23H,7,14-15H2,1-3H3,(H,27,31) |
| InChIKey | JHGQKYAWBIJBST-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|