C25H26Cl2N4O2S — CID 133223166
5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223166) has the molecular formula C25H26Cl2N4O2S and a molecular weight of 517.48 g/mol. Its IUPAC name is 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223166 |
| Molecular Formula | C25H26Cl2N4O2S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(-c3cccc(Cl)c3Cl)o2)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C25H26Cl2N4O2S/c26-18-6-3-5-17(22(18)27)20-8-9-21(33-20)24-23(19-7-1-2-10-28-19)29-25(34)31(24)12-4-11-30-13-15-32-16-14-30/h1-3,5-10,23-24H,4,11-16H2,(H,29,34) |
| InChIKey | SZHYHQTZJARWMJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|