C23H21Cl2N3O2S — CID 133223662
5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223662) has the molecular formula C23H21Cl2N3O2S and a molecular weight of 474.41 g/mol. Its IUPAC name is 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223662 |
| Molecular Formula | C23H21Cl2N3O2S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 5-[5-(2,3-dichlorophenyl)furan-2-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(-c3cccc(Cl)c3Cl)o2)N1CC1CCCO1 |
| InChI | InChI=1S/C23H21Cl2N3O2S/c24-16-7-3-6-15(20(16)25)18-9-10-19(30-18)22-21(17-8-1-2-11-26-17)27-23(31)28(22)13-14-5-4-12-29-14/h1-3,6-11,14,21-22H,4-5,12-13H2,(H,27,31) |
| InChIKey | LBPSANGHQQSUAO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|