C27H24Cl2N4OS — CID 133242155
1-(3-anilinopropyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133242155) has the molecular formula C27H24Cl2N4OS and a molecular weight of 523.49 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-anilinopropyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133242155 |
| Molecular Formula | C27H24Cl2N4OS |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 1-(3-anilinopropyl)-5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(-c3cccc(Cl)c3Cl)o2)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C27H24Cl2N4OS/c28-20-11-6-10-19(24(20)29)22-13-14-23(34-22)26-25(21-12-4-5-15-31-21)32-27(35)33(26)17-7-16-30-18-8-2-1-3-9-18/h1-6,8-15,25-26,30H,7,16-17H2,(H,32,35) |
| InChIKey | XFFNUSCJBVEQJI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 53.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|