C28H26N4O3S — CID 100533146
2-[5-[(4R,5S)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 100533146) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-[5-[(4R,5S)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(4R,5S)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 100533146 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[5-[(4R,5S)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)o1 |
| InChI | InChI=1S/C28H26N4O3S/c33-27(34)21-12-5-4-11-20(21)23-14-15-24(35-23)26-25(22-13-6-7-16-30-22)31-28(36)32(26)18-8-17-29-19-9-2-1-3-10-19/h1-7,9-16,25-26,29H,8,17-18H2,(H,31,36)(H,33,34)/t25-,26+/m1/s1 |
| InChIKey | BFYIUTCCDMPNEP-FTJBHMTQSA-N |
| XLogP | 5.51 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|