C27H25N5O3S — CID 100533068
(4S,5R)-1-(3-anilinopropyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100533068) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is (4S,5R)-1-(3-anilinopropyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(3-anilinopropyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100533068 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (4S,5R)-1-(3-anilinopropyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)o1 |
| InChI | InChI=1S/C27H25N5O3S/c33-32(34)22-13-5-4-11-20(22)23-14-15-24(35-23)26-25(21-12-6-7-16-29-21)30-27(36)31(26)18-8-17-28-19-9-2-1-3-10-19/h1-7,9-16,25-26,28H,8,17-18H2,(H,30,36)/t25-,26+/m1/s1 |
| InChIKey | KLQOVDLNVAPPGI-FTJBHMTQSA-N |
| XLogP | 5.72 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|