C28H25N5O4S — CID 100685350
N-(4-methylphenyl)-3-[(4R,5R)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100685350) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-[(4R,5R)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(4-methylphenyl)-3-[(4R,5R)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100685350 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | N-(4-methylphenyl)-3-[(4R,5R)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2ccc(-c3ccccc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C28H25N5O4S/c1-18-9-11-19(12-10-18)30-25(34)15-17-32-27(26(31-28(32)38)21-7-4-5-16-29-21)24-14-13-23(37-24)20-6-2-3-8-22(20)33(35)36/h2-14,16,26-27H,15,17H2,1H3,(H,30,34)(H,31,38)/t26-,27-/m0/s1 |
| InChIKey | LVJLNCGDFYQGGT-SVBPBHIXSA-N |
| XLogP | 5.56 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|