C22H22ClN3O2S — CID 133155402
5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133155402) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133155402 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(Cl)cccc1-c1ccc(C2C(c3ccccn3)NC(=S)N2CCCO)o1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-14-15(6-4-7-16(14)23)18-9-10-19(28-18)21-20(17-8-2-3-11-24-17)25-22(29)26(21)12-5-13-27/h2-4,6-11,20-21,27H,5,12-13H2,1H3,(H,25,29) |
| InChIKey | AXTPRYSKISUKFU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|