C24H24Cl2N4O2S — CID 133223000
5-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223000) has the molecular formula C24H24Cl2N4O2S and a molecular weight of 503.46 g/mol. Its IUPAC name is 5-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223000 |
| Molecular Formula | C24H24Cl2N4O2S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 5-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(-c3ccc(Cl)c(Cl)c3)o2)N1CCN1CCOCC1 |
| InChI | InChI=1S/C24H24Cl2N4O2S/c25-17-5-4-16(15-18(17)26)20-6-7-21(32-20)23-22(19-3-1-2-8-27-19)28-24(33)30(23)10-9-29-11-13-31-14-12-29/h1-8,15,22-23H,9-14H2,(H,28,33) |
| InChIKey | KZCIKSAGOIZWBI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|