C28H26ClN3O2S — CID 100602264
(4S,5S)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100602264) has the molecular formula C28H26ClN3O2S and a molecular weight of 504.06 g/mol. Its IUPAC name is (4S,5S)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100602264 |
| Molecular Formula | C28H26ClN3O2S |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | (4S,5S)-5-[5-(3-chloro-2-methylphenyl)furan-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(Cl)cccc1-c1ccc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC(C)C)cc2)o1 |
| InChI | InChI=1S/C28H26ClN3O2S/c1-17(2)33-20-12-10-19(11-13-20)32-27(26(31-28(32)35)23-9-4-5-16-30-23)25-15-14-24(34-25)21-7-6-8-22(29)18(21)3/h4-17,26-27H,1-3H3,(H,31,35)/t26-,27-/m1/s1 |
| InChIKey | MZXJBZWKXVIYEX-KAYWLYCHSA-N |
| XLogP | 7.27 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|