C26H20Cl2N4O2S — CID 133156920
N-[4-[5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 133156920) has the molecular formula C26H20Cl2N4O2S and a molecular weight of 523.45 g/mol. Its IUPAC name is N-[4-[5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133156920 |
| Molecular Formula | C26H20Cl2N4O2S |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-[4-[5-[5-(2,3-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C26H20Cl2N4O2S/c1-15(33)30-16-8-10-17(11-9-16)32-25(24(31-26(32)35)20-7-2-3-14-29-20)22-13-12-21(34-22)18-5-4-6-19(27)23(18)28/h2-14,24-25H,1H3,(H,30,33)(H,31,35) |
| InChIKey | PHEVUAZVSOEJBT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|