C23H25ClN4OS — CID 100511793
(4R,5R)-5-(1-tert-butylpyrrol-3-yl)-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100511793) has the molecular formula C23H25ClN4OS and a molecular weight of 441.00 g/mol. Its IUPAC name is (4R,5R)-5-(1-tert-butylpyrrol-3-yl)-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-(1-tert-butylpyrrol-3-yl)-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100511793 |
| Molecular Formula | C23H25ClN4OS |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (4R,5R)-5-(1-tert-butylpyrrol-3-yl)-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccn(C(C)(C)C)c2)cc1Cl |
| InChI | InChI=1S/C23H25ClN4OS/c1-23(2,3)27-12-10-15(14-27)21-20(18-7-5-6-11-25-18)26-22(30)28(21)16-8-9-19(29-4)17(24)13-16/h5-14,20-21H,1-4H3,(H,26,30)/t20-,21+/m0/s1 |
| InChIKey | ILAHOPLTJXMLQK-LEWJYISDSA-N |
| XLogP | 5.48 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|