C22H24N4OS — CID 133156313
5-(1-tert-butylpyrrol-3-yl)-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156313) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 5-(1-tert-butylpyrrol-3-yl)-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-tert-butylpyrrol-3-yl)-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156313 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-(1-tert-butylpyrrol-3-yl)-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC(C)(C)n1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C22H24N4OS/c1-22(2,3)25-13-11-15(14-25)20-19(18-6-4-5-12-23-18)24-21(28)26(20)16-7-9-17(27)10-8-16/h4-14,19-20,27H,1-3H3,(H,24,28) |
| InChIKey | LEECMHDQDTYMCQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|