C35H34N4OS — CID 133183752
5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183752) has the molecular formula C35H34N4OS and a molecular weight of 558.75 g/mol. Its IUPAC name is 5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183752 |
| Molecular Formula | C35H34N4OS |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=S)NC(c4ccccn4)C3c3cc(C)n(-c4c(C)cccc4C)c3C)cc2)cc1 |
| InChI | InChI=1S/C35H34N4OS/c1-22-12-16-28(17-13-22)40-29-18-14-27(15-19-29)39-34(32(37-35(39)41)31-11-6-7-20-36-31)30-21-25(4)38(26(30)5)33-23(2)9-8-10-24(33)3/h6-21,32,34H,1-5H3,(H,37,41) |
| InChIKey | WFGOHNWEKBPQJE-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|