C36H30N4OS — CID 133183378
5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183378) has the molecular formula C36H30N4OS and a molecular weight of 566.73 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183378 |
| Molecular Formula | C36H30N4OS |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(Oc3ccccc3)cc2)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C36H30N4OS/c1-24-23-31(25(2)39(24)33-17-10-12-26-11-6-7-15-30(26)33)35-34(32-16-8-9-22-37-32)38-36(42)40(35)27-18-20-29(21-19-27)41-28-13-4-3-5-14-28/h3-23,34-35H,1-2H3,(H,38,42) |
| InChIKey | RGWHWHSZJIKORX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|