C33H27F3N4OS — CID 133183385
5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183385) has the molecular formula C33H27F3N4OS and a molecular weight of 584.67 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183385 |
| Molecular Formula | C33H27F3N4OS |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(Oc3ccccc3)cc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C33H27F3N4OS/c1-21-20-26(22(2)39(21)29-14-7-6-12-27(29)33(34,35)36)31-30(28-13-8-9-19-37-28)38-32(42)40(31)23-15-17-25(18-16-23)41-24-10-4-3-5-11-24/h3-20,30-31H,1-2H3,(H,38,42) |
| InChIKey | BSGQGIJDCDSKOZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|