C29H27F3N4S — CID 133158425
1-(3,5-dimethylphenyl)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158425) has the molecular formula C29H27F3N4S and a molecular weight of 520.62 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3,5-dimethylphenyl)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158425 |
| Molecular Formula | C29H27F3N4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C)cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)c1 |
| InChI | InChI=1S/C29H27F3N4S/c1-17-13-18(2)15-21(14-17)36-27(26(34-28(36)37)24-10-7-8-12-33-24)22-16-19(3)35(20(22)4)25-11-6-5-9-23(25)29(30,31)32/h5-16,26-27H,1-4H3,(H,34,37) |
| InChIKey | GOGIECUJPCSQHY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|