C35H41N5OS — CID 133244183
1-(4-cyclopentyloxyphenyl)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133244183) has the molecular formula C35H41N5OS and a molecular weight of 579.81 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133244183 |
| Molecular Formula | C35H41N5OS |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccc(OC4CCCC4)cc3)c2C)cc1 |
| InChI | InChI=1S/C35H41N5OS/c1-5-38(6-2)26-14-16-27(17-15-26)39-24(3)23-31(25(39)4)34-33(32-13-9-10-22-36-32)37-35(42)40(34)28-18-20-30(21-19-28)41-29-11-7-8-12-29/h9-10,13-23,29,33-34H,5-8,11-12H2,1-4H3,(H,37,42) |
| InChIKey | IQFWKVICFRMLHW-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|