C33H34N4O3S — CID 100610112
methyl 2-[3-[(4R,5S)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 100610112) has the molecular formula C33H34N4O3S and a molecular weight of 566.73 g/mol. Its IUPAC name is methyl 2-[3-[(4R,5S)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[3-[(4R,5S)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 100610112 |
| Molecular Formula | C33H34N4O3S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | methyl 2-[3-[(4R,5S)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(C)cc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c1C |
| InChI | InChI=1S/C33H34N4O3S/c1-21-20-27(22(2)36(21)29-14-7-6-12-26(29)32(38)39-3)31-30(28-13-8-9-19-34-28)35-33(41)37(31)23-15-17-25(18-16-23)40-24-10-4-5-11-24/h6-9,12-20,24,30-31H,4-5,10-11H2,1-3H3,(H,35,41)/t30-,31-/m1/s1 |
| InChIKey | DHUSDAFMZJDZEU-FIRIVFDPSA-N |
| XLogP | 6.77 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|