C30H30FN5OS — CID 133156670
5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-morpholin-4-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156670) has the molecular formula C30H30FN5OS and a molecular weight of 527.67 g/mol. Its IUPAC name is 5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-morpholin-4-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-morpholin-4-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156670 |
| Molecular Formula | C30H30FN5OS |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-morpholin-4-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(N3CCOCC3)cc2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C30H30FN5OS/c1-20-19-24(21(2)35(20)27-9-4-3-7-25(27)31)29-28(26-8-5-6-14-32-26)33-30(38)36(29)23-12-10-22(11-13-23)34-15-17-37-18-16-34/h3-14,19,28-29H,15-18H2,1-2H3,(H,33,38) |
| InChIKey | VSRYPKJFSZRWGZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|