C31H34N6O3S2 — CID 100611127
N-[4-[(4S,5R)-5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100611127) has the molecular formula C31H34N6O3S2 and a molecular weight of 602.79 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5R)-5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100611127 |
| Molecular Formula | C31H34N6O3S2 |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | N-[4-[(4S,5R)-5-[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)c(C)n1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H34N6O3S2/c1-21-20-27(22(2)36(21)25-13-11-24(12-14-25)35-16-18-40-19-17-35)30-29(28-6-4-5-15-32-28)33-31(41)37(30)26-9-7-23(8-10-26)34-42(3,38)39/h4-15,20,29-30,34H,16-19H2,1-3H3,(H,33,41)/t29-,30-/m1/s1 |
| InChIKey | KKZVGJVXTVDESW-LOYHVIPDSA-N |
| XLogP | 4.87 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|