C26H23FN4S — CID 133182381
5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182381) has the molecular formula C26H23FN4S and a molecular weight of 442.56 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182381 |
| Molecular Formula | C26H23FN4S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccccc2F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H23FN4S/c1-17-16-20(18(2)30(17)19-10-4-3-5-11-19)25-24(22-13-8-9-15-28-22)29-26(32)31(25)23-14-7-6-12-21(23)27/h3-16,24-25H,1-2H3,(H,29,32) |
| InChIKey | ZSHRWRZCWPLUOL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|