C21H21FN4S — CID 133182373
1-(2-fluorophenyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione (PubChem CID 133182373) has the molecular formula C21H21FN4S and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione.
| Compound Name | 1-(2-fluorophenyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133182373 |
| Molecular Formula | C21H21FN4S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(2-fluorophenyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccccc2F)c(C)n1C |
| InChI | InChI=1S/C21H21FN4S/c1-13-12-15(14(2)25(13)3)20-19(17-9-6-7-11-23-17)24-21(27)26(20)18-10-5-4-8-16(18)22/h4-12,19-20H,1-3H3,(H,24,27) |
| InChIKey | RRVMOGHZRXKNAJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|