C28H28N4OS — CID 133183049
5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183049) has the molecular formula C28H28N4OS and a molecular weight of 468.63 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183049 |
| Molecular Formula | C28H28N4OS |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1N1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C28H28N4OS/c1-18-12-14-21(15-13-18)31-19(2)17-22(20(31)3)27-26(23-9-7-8-16-29-23)30-28(34)32(27)24-10-5-6-11-25(24)33-4/h5-17,26-27H,1-4H3,(H,30,34) |
| InChIKey | XKTNOOFGEULADD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|