C26H25N5OS — CID 133183018
5-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183018) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183018 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 5-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1N1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2cccnc2)c1C |
| InChI | InChI=1S/C26H25N5OS/c1-17-15-20(18(2)30(17)19-9-8-13-27-16-19)25-24(21-10-6-7-14-28-21)29-26(33)31(25)22-11-4-5-12-23(22)32-3/h4-16,24-25H,1-3H3,(H,29,33) |
| InChIKey | JQKCZZLXCCJNSD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|