C23H26N4OS — CID 133183039
5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183039) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183039 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCn1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccccc2OC)c1C |
| InChI | InChI=1S/C23H26N4OS/c1-5-26-15(2)14-17(16(26)3)22-21(18-10-8-9-13-24-18)25-23(29)27(22)19-11-6-7-12-20(19)28-4/h6-14,21-22H,5H2,1-4H3,(H,25,29) |
| InChIKey | RNHJIJGQRRFIEC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|