C23H25BrN4S — CID 100505971
(4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100505971) has the molecular formula C23H25BrN4S and a molecular weight of 469.45 g/mol. Its IUPAC name is (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100505971 |
| Molecular Formula | C23H25BrN4S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCn1c(C)cc([C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(Br)c(C)c2)c1C |
| InChI | InChI=1S/C23H25BrN4S/c1-5-27-15(3)13-18(16(27)4)22-21(20-8-6-7-11-25-20)26-23(29)28(22)17-9-10-19(24)14(2)12-17/h6-13,21-22H,5H2,1-4H3,(H,26,29)/t21-,22-/m0/s1 |
| InChIKey | ONWVKAFKEZCDBI-VXKWHMMOSA-N |
| XLogP | 5.77 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|