C24H23N5OS2 — CID 133183013
5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183013) has the molecular formula C24H23N5OS2 and a molecular weight of 461.62 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183013 |
| Molecular Formula | C24H23N5OS2 |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1N1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2nccs2)c1C |
| InChI | InChI=1S/C24H23N5OS2/c1-15-14-17(16(2)28(15)24-26-12-13-32-24)22-21(18-8-6-7-11-25-18)27-23(31)29(22)19-9-4-5-10-20(19)30-3/h4-14,21-22H,1-3H3,(H,27,31) |
| InChIKey | ISJPAUINVQYOOF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|