C24H21N5O2S2 — CID 133156969
1-(1,3-benzodioxol-5-yl)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156969) has the molecular formula C24H21N5O2S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156969 |
| Molecular Formula | C24H21N5O2S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc3c(c2)OCO3)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C24H21N5O2S2/c1-14-11-17(15(2)28(14)24-26-9-10-33-24)22-21(18-5-3-4-8-25-18)27-23(32)29(22)16-6-7-19-20(12-16)31-13-30-19/h3-12,21-22H,13H2,1-2H3,(H,27,32) |
| InChIKey | NBGWKNIEFUUZTG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|