C29H28N4O2S — CID 133157029
1-(1,3-benzodioxol-5-yl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157029) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157029 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(C)c(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccc4c(c3)OCO4)c2C)c1 |
| InChI | InChI=1S/C29H28N4O2S/c1-17-8-9-18(2)24(13-17)32-19(3)14-22(20(32)4)28-27(23-7-5-6-12-30-23)31-29(36)33(28)21-10-11-25-26(15-21)35-16-34-25/h5-15,27-28H,16H2,1-4H3,(H,31,36) |
| InChIKey | DZELUGVIEUGTIB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|