C23H24N4O3S — CID 133181946
5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133181946) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181946 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-1-(2-hydroxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CCO)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H24N4O3S/c1-14-11-17(15(2)27(14)16-6-7-19-20(12-16)30-13-29-19)22-21(18-5-3-4-8-24-18)25-23(31)26(22)9-10-28/h3-8,11-12,21-22,28H,9-10,13H2,1-2H3,(H,25,31) |
| InChIKey | RJIQGYQIOXACRZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|