C27H35N5OS — CID 133182109
5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182109) has the molecular formula C27H35N5OS and a molecular weight of 477.68 g/mol. Its IUPAC name is 5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182109 |
| Molecular Formula | C27H35N5OS |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCCO)c2C)cc1 |
| InChI | InChI=1S/C27H35N5OS/c1-5-30(6-2)21-11-13-22(14-12-21)32-19(3)18-23(20(32)4)26-25(24-10-7-8-15-28-24)29-27(34)31(26)16-9-17-33/h7-8,10-15,18,25-26,33H,5-6,9,16-17H2,1-4H3,(H,29,34) |
| InChIKey | UMBGDCJGPCAWSC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|