C33H37FN6OS — CID 133208818
3-[5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 133208818) has the molecular formula C33H37FN6OS and a molecular weight of 584.77 g/mol. Its IUPAC name is 3-[5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 133208818 |
| Molecular Formula | C33H37FN6OS |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 3-[5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCC(=O)Nc3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C33H37FN6OS/c1-5-38(6-2)26-14-16-27(17-15-26)40-22(3)21-28(23(40)4)32-31(29-9-7-8-19-35-29)37-33(42)39(32)20-18-30(41)36-25-12-10-24(34)11-13-25/h7-17,19,21,31-32H,5-6,18,20H2,1-4H3,(H,36,41)(H,37,42) |
| InChIKey | IGTLKEPOHADLKE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|