C34H40N6OS — CID 100722875
3-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide (PubChem CID 100722875) has the molecular formula C34H40N6OS and a molecular weight of 580.80 g/mol. Its IUPAC name is 3-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide.
| Compound Name | 3-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100722875 |
| Molecular Formula | C34H40N6OS |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 3-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)NC(=S)N3CCC(=O)Nc3ccccc3C)c2C)cc1 |
| InChI | InChI=1S/C34H40N6OS/c1-6-38(7-2)26-15-17-27(18-16-26)40-24(4)22-28(25(40)5)33-32(30-14-10-11-20-35-30)37-34(42)39(33)21-19-31(41)36-29-13-9-8-12-23(29)3/h8-18,20,22,32-33H,6-7,19,21H2,1-5H3,(H,36,41)(H,37,42)/t32-,33+/m0/s1 |
| InChIKey | KERQDLAEHFPLSS-JHOUSYSJSA-N |
| XLogP | 6.65 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|