C33H38N6OS — CID 100668017
3-[(4S,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 100668017) has the molecular formula C33H38N6OS and a molecular weight of 566.78 g/mol. Its IUPAC name is 3-[(4S,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[(4S,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 100668017 |
| Molecular Formula | C33H38N6OS |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 3-[(4S,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc([C@H]3[C@@H](c4ccccn4)NC(=S)N3CCC(=O)Nc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C33H38N6OS/c1-5-37(6-2)26-15-17-27(18-16-26)39-23(3)22-28(24(39)4)32-31(29-14-10-11-20-34-29)36-33(41)38(32)21-19-30(40)35-25-12-8-7-9-13-25/h7-18,20,22,31-32H,5-6,19,21H2,1-4H3,(H,35,40)(H,36,41)/t31-,32+/m1/s1 |
| InChIKey | SCMSIGMQUPWAHE-ZWXJPIIXSA-N |
| XLogP | 6.34 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|