C31H31N5O3S — CID 133242798
N-[4-[5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide (PubChem CID 133242798) has the molecular formula C31H31N5O3S and a molecular weight of 553.69 g/mol. Its IUPAC name is N-[4-[5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide.
| Compound Name | N-[4-[5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 133242798 |
| Molecular Formula | C31H31N5O3S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | N-[4-[5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc4c(c3)OCO4)c2C)cc1C |
| InChI | InChI=1S/C31H31N5O3S/c1-5-28(37)33-24-11-9-21(14-18(24)2)36-30(29(34-31(36)40)25-8-6-7-13-32-25)23-15-19(3)35(20(23)4)22-10-12-26-27(16-22)39-17-38-26/h6-16,29-30H,5,17H2,1-4H3,(H,33,37)(H,34,40) |
| InChIKey | RVQTUUYWFFLKJK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|