C30H32N4O2S — CID 133178222
1-(2,4-dimethoxyphenyl)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133178222) has the molecular formula C30H32N4O2S and a molecular weight of 512.68 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133178222 |
| Molecular Formula | C30H32N4O2S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cc(C)cc(C)c3)c2C)c(OC)c1 |
| InChI | InChI=1S/C30H32N4O2S/c1-18-13-19(2)15-22(14-18)33-20(3)16-24(21(33)4)29-28(25-9-7-8-12-31-25)32-30(37)34(29)26-11-10-23(35-5)17-27(26)36-6/h7-17,28-29H,1-6H3,(H,32,37) |
| InChIKey | ZPKFTVFJZAZQMM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|