C26H29N5O3S — CID 100525435
(4S,5S)-1-cyclopentyl-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100525435) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is (4S,5S)-1-cyclopentyl-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-cyclopentyl-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100525435 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | (4S,5S)-1-cyclopentyl-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2C2CCCC2)c1C |
| InChI | InChI=1S/C26H29N5O3S/c1-16-14-20(17(2)29(16)22-12-11-19(31(32)33)15-23(22)34-3)25-24(21-10-6-7-13-27-21)28-26(35)30(25)18-8-4-5-9-18/h6-7,10-15,18,24-25H,4-5,8-9H2,1-3H3,(H,28,35)/t24-,25+/m1/s1 |
| InChIKey | OQBOHKMKPZYFIK-RPBOFIJWSA-N |
| XLogP | 5.32 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|