C26H29ClN4OS — CID 100525589
(4R,5R)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100525589) has the molecular formula C26H29ClN4OS and a molecular weight of 481.07 g/mol. Its IUPAC name is (4R,5R)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100525589 |
| Molecular Formula | C26H29ClN4OS |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (4R,5R)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)c1C |
| InChI | InChI=1S/C26H29ClN4OS/c1-16-14-20(17(2)30(16)22-15-18(27)11-12-23(22)32-3)25-24(21-10-6-7-13-28-21)29-26(33)31(25)19-8-4-5-9-19/h6-7,10-15,19,24-25H,4-5,8-9H2,1-3H3,(H,29,33)/t24-,25+/m0/s1 |
| InChIKey | STRCSHYLOPPGRB-LOSJGSFVSA-N |
| XLogP | 6.07 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|