C27H26ClN5OS — CID 133181621
5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-4-ylmethyl)imidazolidine-2-thione (PubChem CID 133181621) has the molecular formula C27H26ClN5OS and a molecular weight of 504.06 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-4-ylmethyl)imidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-4-ylmethyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133181621 |
| Molecular Formula | C27H26ClN5OS |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-4-ylmethyl)imidazolidine-2-thione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2Cc2ccncc2)c1C |
| InChI | InChI=1S/C27H26ClN5OS/c1-17-14-21(18(2)33(17)23-15-20(28)7-8-24(23)34-3)26-25(22-6-4-5-11-30-22)31-27(35)32(26)16-19-9-12-29-13-10-19/h4-15,25-26H,16H2,1-3H3,(H,31,35) |
| InChIKey | QBKMONYYFGLAMQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|