C26H25ClN4OS — CID 133180936
5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(furan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133180936) has the molecular formula C26H25ClN4OS and a molecular weight of 477.03 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(furan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(furan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133180936 |
| Molecular Formula | C26H25ClN4OS |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(furan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2Cc2ccco2)c1C |
| InChI | InChI=1S/C26H25ClN4OS/c1-16-9-10-19(27)14-23(16)31-17(2)13-21(18(31)3)25-24(22-8-4-5-11-28-22)29-26(33)30(25)15-20-7-6-12-32-20/h4-14,24-25H,15H2,1-3H3,(H,29,33) |
| InChIKey | RIFSVRUHTXZYKE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|