C25H27N5O5S — CID 133155519
ethyl 2-[5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 133155519) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is ethyl 2-[5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 133155519 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | ethyl 2-[5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc([N+](=O)[O-])cc2OC)c1C |
| InChI | InChI=1S/C25H27N5O5S/c1-5-35-22(31)14-28-24(23(27-25(28)36)19-8-6-7-11-26-19)18-12-15(2)29(16(18)3)20-10-9-17(30(32)33)13-21(20)34-4/h6-13,23-24H,5,14H2,1-4H3,(H,27,36) |
| InChIKey | RDICOPNTZCNLKC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|