C32H34N6O4S — CID 100676150
N-(2-ethylphenyl)-3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100676150) has the molecular formula C32H34N6O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100676150 |
| Molecular Formula | C32H34N6O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@@H]1c1cc(C)n(-c2cc([N+](=O)[O-])ccc2OC)c1C |
| InChI | InChI=1S/C32H34N6O4S/c1-5-22-10-6-7-11-25(22)34-29(39)15-17-36-31(30(35-32(36)43)26-12-8-9-16-33-26)24-18-20(2)37(21(24)3)27-19-23(38(40)41)13-14-28(27)42-4/h6-14,16,18-19,30-31H,5,15,17H2,1-4H3,(H,34,39)(H,35,43)/t30-,31+/m1/s1 |
| InChIKey | PNYNGCDLFJGDIQ-JSOSNVBQSA-N |
| XLogP | 5.97 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|